About Eipa
Eipa (PubChem CID 1795) has the molecular formula C11H18ClN7O
and a molecular weight of 299.76 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | Eipa |
| PubChem CID | 1795 |
| Molecular Formula | C11H18ClN7O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide |
| SMILES | CCN(C1=NC(=C(N=C1Cl)C(=O)N=C(N)N)N)C(C)C |
| InChI | InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | QDERNBXNXJCIQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 372 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze Eipa with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Eipa?
The IUPAC name of Eipa (CID 1795) is 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide.
What is the SMILES notation for Eipa?
The canonical SMILES for Eipa is CCN(C1=NC(=C(N=C1Cl)C(=O)N=C(N)N)N)C(C)C.
What is the InChIKey of Eipa?
The InChIKey is QDERNBXNXJCIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20).
What are the key properties of Eipa?
Eipa has a molecular weight of 299.76 g/mol, XLogP of 1.30, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Eipa is sourced from PubChem (CID 1795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).