C11H18ClN7O — CID 1795
3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide (PubChem CID 1795) has the molecular formula C11H18ClN7O and a molecular weight of 299.77 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 1795 |
| Molecular Formula | C11H18ClN7O |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[ethyl(propan-2-yl)amino]pyrazine-2-carboxamide |
| SMILES | CCN(c1nc(N)c(C(=O)N=C(N)N)nc1Cl)C(C)C |
| InChI | InChI=1S/C11H18ClN7O/c1-4-19(5(2)3)9-7(12)16-6(8(13)17-9)10(20)18-11(14)15/h5H,4H2,1-3H3,(H2,13,17)(H4,14,15,18,20) |
| InChIKey | QDERNBXNXJCIQK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|