C34H41ClN6O3 — CID 44548664
3,5-diamino-N-[2-[benzyl-bis[3-(4-methoxyphenyl)propyl]azaniumyl]ethyl]-6-chloropyrazine-2-carboximidate (PubChem CID 44548664) has the molecular formula C34H41ClN6O3 and a molecular weight of 617.19 g/mol. Its IUPAC name is 3,5-diamino-N-[2-[benzyl-bis[3-(4-methoxyphenyl)propyl]azaniumyl]ethyl]-6-chloropyrazine-2-carboximidate.
| Compound Name | 3,5-diamino-N-[2-[benzyl-bis[3-(4-methoxyphenyl)propyl]azaniumyl]ethyl]-6-chloropyrazine-2-carboximidate |
|---|---|
| PubChem CID | 44548664 |
| Molecular Formula | C34H41ClN6O3 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 3,5-diamino-N-[2-[benzyl-bis[3-(4-methoxyphenyl)propyl]azaniumyl]ethyl]-6-chloropyrazine-2-carboximidate |
| SMILES | COc1ccc(CCC[N+](CCCc2ccc(OC)cc2)(CC/N=C(\[O-])c2nc(Cl)c(N)nc2N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H41ClN6O3/c1-43-28-16-12-25(13-17-28)10-6-21-41(24-27-8-4-3-5-9-27,22-7-11-26-14-18-29(44-2)19-15-26)23-20-38-34(42)30-32(36)40-33(37)31(35)39-30/h3-5,8-9,12-19H,6-7,10-11,20-24H2,1-2H3,(H4-,36,37,38,40,42) |
| InChIKey | GVYUBRLOBIBGPW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|