C16H21ClN10O — CID 57343904
(1E)-1-[amino-[2-(3,5-diamino-6-chloropyrazine-2-carbonyl)hydrazinyl]methylidene]-2-(3-phenylpropyl)guanidine (PubChem CID 57343904) has the molecular formula C16H21ClN10O and a molecular weight of 404.87 g/mol. Its IUPAC name is (1E)-1-[amino-[2-(3,5-diamino-6-chloropyrazine-2-carbonyl)hydrazinyl]methylidene]-2-(3-phenylpropyl)guanidine.
| Compound Name | (1E)-1-[amino-[2-(3,5-diamino-6-chloropyrazine-2-carbonyl)hydrazinyl]methylidene]-2-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 57343904 |
| Molecular Formula | C16H21ClN10O |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (1E)-1-[amino-[2-(3,5-diamino-6-chloropyrazine-2-carbonyl)hydrazinyl]methylidene]-2-(3-phenylpropyl)guanidine |
| SMILES | NC(=N\CCCc1ccccc1)/N=C(\N)NNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C16H21ClN10O/c17-11-13(19)24-12(18)10(23-11)14(28)26-27-16(21)25-15(20)22-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,26,28)(H4,18,19,24)(H5,20,21,22,25,27) |
| InChIKey | NAYDMDMBBDSXBJ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 195.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|