C11H19ClN6O — CID 57393343
3,5-diamino-6-chloro-N-[4-(dimethylamino)butyl]pyrazine-2-carboxamide (PubChem CID 57393343) has the molecular formula C11H19ClN6O and a molecular weight of 286.77 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[4-(dimethylamino)butyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[4-(dimethylamino)butyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 57393343 |
| Molecular Formula | C11H19ClN6O |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[4-(dimethylamino)butyl]pyrazine-2-carboxamide |
| SMILES | CN(C)CCCCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C11H19ClN6O/c1-18(2)6-4-3-5-15-11(19)7-9(13)17-10(14)8(12)16-7/h3-6H2,1-2H3,(H,15,19)(H4,13,14,17) |
| InChIKey | OPXUVRFROIYQJS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|