C9H11ClN8O2 — CID 58385780
CID 58385780 (PubChem CID 58385780) has the molecular formula C9H11ClN8O2 and a molecular weight of 298.69 g/mol.
| Compound Name | CID 58385780 |
|---|---|
| PubChem CID | 58385780 |
| Molecular Formula | C9H11ClN8O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | — |
| SMILES | [CH]Nc1nc(N)c(C(=O)/N=C(\N)NC(=O)CN)nc1Cl |
| InChI | InChI=1S/C9H11ClN8O2/c1-14-7-5(10)16-4(6(12)17-7)8(20)18-9(13)15-3(19)2-11/h1H,2,11H2,(H3,12,14,17)(H3,13,15,18,19,20) |
| InChIKey | LAALKQDNKGHOPF-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|