C8H10ClN11O — CID 57401403
3-amino-6-chloro-N-(diaminomethylidene)-5-(2H-tetrazol-5-ylmethylamino)pyrazine-2-carboxamide (PubChem CID 57401403) has the molecular formula C8H10ClN11O and a molecular weight of 311.70 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(diaminomethylidene)-5-(2H-tetrazol-5-ylmethylamino)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-(2H-tetrazol-5-ylmethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 57401403 |
| Molecular Formula | C8H10ClN11O |
| Molecular Weight | 311.70 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-(2H-tetrazol-5-ylmethylamino)pyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(NCc2nn[nH]n2)nc1N |
| InChI | InChI=1S/C8H10ClN11O/c9-4-6(13-1-2-17-19-20-18-2)15-5(10)3(14-4)7(21)16-8(11)12/h1H2,(H3,10,13,15)(H4,11,12,16,21)(H,17,18,19,20) |
| InChIKey | UWNBWRDWTWDVKO-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 199.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.70 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|