C10H12ClN7O2 — CID 58385786
CID 58385786 (PubChem CID 58385786) has the molecular formula C10H12ClN7O2 and a molecular weight of 297.71 g/mol.
| Compound Name | CID 58385786 |
|---|---|
| PubChem CID | 58385786 |
| Molecular Formula | C10H12ClN7O2 |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | — |
| SMILES | [CH]Nc1nc(N)c(C(=O)/N=C(\N)NC(=O)CC)nc1Cl |
| InChI | InChI=1S/C10H12ClN7O2/c1-3-4(19)15-10(13)18-9(20)5-7(12)17-8(14-2)6(11)16-5/h2H,3H2,1H3,(H3,12,14,17)(H3,13,15,18,19,20) |
| InChIKey | GTOMUTMOPCLGLV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|