C13H13ClFN7O — CID 57394421
3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 57394421) has the molecular formula C13H13ClFN7O and a molecular weight of 337.75 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 57394421 |
| Molecular Formula | C13H13ClFN7O |
| Molecular Weight | 337.75 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-fluorophenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(NCc2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C13H13ClFN7O/c14-9-11(19-5-6-1-3-7(15)4-2-6)21-10(16)8(20-9)12(23)22-13(17)18/h1-4H,5H2,(H3,16,19,21)(H4,17,18,22,23) |
| InChIKey | WGUJBGXOLFQHAZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.75 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|