C16H22ClN7O — CID 153371782
3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-methylphenyl)methylamino]pyrazine-2-carboxamide;ethane (PubChem CID 153371782) has the molecular formula C16H22ClN7O and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-methylphenyl)methylamino]pyrazine-2-carboxamide;ethane.
| Compound Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-methylphenyl)methylamino]pyrazine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 153371782 |
| Molecular Formula | C16H22ClN7O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-[(4-methylphenyl)methylamino]pyrazine-2-carboxamide;ethane |
| SMILES | CC.Cc1ccc(CNc2nc(N)c(C(=O)N=C(N)N)nc2Cl)cc1 |
| InChI | InChI=1S/C14H16ClN7O.C2H6/c1-7-2-4-8(5-3-7)6-19-12-10(15)20-9(11(16)21-12)13(23)22-14(17)18;1-2/h2-5H,6H2,1H3,(H3,16,19,21)(H4,17,18,22,23);1-2H3 |
| InChIKey | AFCPDEYDRXGENL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|