C8H16ClN7O7S2 — CID 175022867
3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;methanesulfonic acid (PubChem CID 175022867) has the molecular formula C8H16ClN7O7S2 and a molecular weight of 421.85 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;methanesulfonic acid.
| Compound Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 175022867 |
| Molecular Formula | C8H16ClN7O7S2 |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.NC(N)=NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C6H8ClN7O.2CH4O3S/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;2*1-5(2,3)4/h(H4,8,9,13)(H4,10,11,14,15);2*1H3,(H,2,3,4) |
| InChIKey | LQSHYZCWTODTIK-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 268.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|