C12H18ClN7O — CID 11472419
5-amino-3-(azepan-1-yl)-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide (PubChem CID 11472419) has the molecular formula C12H18ClN7O and a molecular weight of 311.78 g/mol. Its IUPAC name is 5-amino-3-(azepan-1-yl)-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide.
| Compound Name | 5-amino-3-(azepan-1-yl)-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11472419 |
| Molecular Formula | C12H18ClN7O |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-amino-3-(azepan-1-yl)-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc(Cl)c(N)nc1N1CCCCCC1 |
| InChI | InChI=1S/C12H18ClN7O/c13-8-9(14)18-10(20-5-3-1-2-4-6-20)7(17-8)11(21)19-12(15)16/h1-6H2,(H2,14,18)(H4,15,16,19,21) |
| InChIKey | ZCZUDNKGBATBJY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|