C10H15Cl2N5O2 — CID 90674683
methyl 3-amino-6-chloro-5-piperazin-1-ylpyrazine-2-carboxylate;hydrochloride (PubChem CID 90674683) has the molecular formula C10H15Cl2N5O2 and a molecular weight of 308.17 g/mol. Its IUPAC name is methyl 3-amino-6-chloro-5-piperazin-1-ylpyrazine-2-carboxylate;hydrochloride.
| Compound Name | methyl 3-amino-6-chloro-5-piperazin-1-ylpyrazine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 90674683 |
| Molecular Formula | C10H15Cl2N5O2 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | methyl 3-amino-6-chloro-5-piperazin-1-ylpyrazine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1nc(Cl)c(N2CCNCC2)nc1N.Cl |
| InChI | InChI=1S/C10H14ClN5O2.ClH/c1-18-10(17)6-8(12)15-9(7(11)14-6)16-4-2-13-3-5-16;/h13H,2-5H2,1H3,(H2,12,15);1H |
| InChIKey | OHERRBJPZFATKB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |