C12H21N5O2 — CID 102808721
methyl 5-amino-3-piperazin-1-yl-1-propylpyrazole-4-carboxylate (PubChem CID 102808721) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 5-amino-3-piperazin-1-yl-1-propylpyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-piperazin-1-yl-1-propylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808721 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | methyl 5-amino-3-piperazin-1-yl-1-propylpyrazole-4-carboxylate |
| SMILES | CCCn1nc(N2CCNCC2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C12H21N5O2/c1-3-6-17-10(13)9(12(18)19-2)11(15-17)16-7-4-14-5-8-16/h14H,3-8,13H2,1-2H3 |
| InChIKey | MRPHLMOGYNBLQF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |