C14H25N5O2 — CID 102808410
methyl 5-amino-1-tert-butyl-3-(4-methylpiperazin-1-yl)pyrazole-4-carboxylate (PubChem CID 102808410) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is methyl 5-amino-1-tert-butyl-3-(4-methylpiperazin-1-yl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-tert-butyl-3-(4-methylpiperazin-1-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808410 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | methyl 5-amino-1-tert-butyl-3-(4-methylpiperazin-1-yl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(N2CCN(C)CC2)nn(C(C)(C)C)c1N |
| InChI | InChI=1S/C14H25N5O2/c1-14(2,3)19-11(15)10(13(20)21-5)12(16-19)18-8-6-17(4)7-9-18/h6-9,15H2,1-5H3 |
| InChIKey | WVGANNSSWKFFMX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |