C13H25N5O2S — CID 102825662
1-tert-butyl-3-(4-methylpiperazin-1-yl)-4-methylsulfonylpyrazol-5-amine (PubChem CID 102825662) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-tert-butyl-3-(4-methylpiperazin-1-yl)-4-methylsulfonylpyrazol-5-amine.
| Compound Name | 1-tert-butyl-3-(4-methylpiperazin-1-yl)-4-methylsulfonylpyrazol-5-amine |
|---|---|
| PubChem CID | 102825662 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-tert-butyl-3-(4-methylpiperazin-1-yl)-4-methylsulfonylpyrazol-5-amine |
| SMILES | CN1CCN(c2nn(C(C)(C)C)c(N)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H25N5O2S/c1-13(2,3)18-11(14)10(21(5,19)20)12(15-18)17-8-6-16(4)7-9-17/h6-9,14H2,1-5H3 |
| InChIKey | DKQUMJVMLWJFPW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |