C13H25N5O2S — CID 102825654
1-tert-butyl-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-5-amine (PubChem CID 102825654) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-tert-butyl-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-5-amine.
| Compound Name | 1-tert-butyl-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-5-amine |
|---|---|
| PubChem CID | 102825654 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-tert-butyl-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-5-amine |
| SMILES | C[C@H]1CN(c2nn(C(C)(C)C)c(N)c2S(C)(=O)=O)CCN1 |
| InChI | InChI=1S/C13H25N5O2S/c1-9-8-17(7-6-15-9)12-10(21(5,19)20)11(14)18(16-12)13(2,3)4/h9,15H,6-8,14H2,1-5H3/t9-/m0/s1 |
| InChIKey | GOUKORFWMPWSSR-VIFPVBQESA-N |
| XLogP | 0.42 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |