C11H19N5O4S — CID 102826319
2-[5-amino-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-1-yl]acetic acid (PubChem CID 102826319) has the molecular formula C11H19N5O4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[5-amino-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-1-yl]acetic acid.
| Compound Name | 2-[5-amino-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 102826319 |
| Molecular Formula | C11H19N5O4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[5-amino-3-[(3S)-3-methylpiperazin-1-yl]-4-methylsulfonylpyrazol-1-yl]acetic acid |
| SMILES | C[C@H]1CN(c2nn(CC(=O)O)c(N)c2S(C)(=O)=O)CCN1 |
| InChI | InChI=1S/C11H19N5O4S/c1-7-5-15(4-3-13-7)11-9(21(2,19)20)10(12)16(14-11)6-8(17)18/h7,13H,3-6,12H2,1-2H3,(H,17,18)/t7-/m0/s1 |
| InChIKey | NEYAZBFIJVTCOB-ZETCQYMHSA-N |
| XLogP | -1.25 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |