C11H15ClN4O — CID 141318308
5-chloro-6-[(3R)-3-methylpiperazin-1-yl]pyridine-3-carboxamide (PubChem CID 141318308) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-chloro-6-[(3R)-3-methylpiperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[(3R)-3-methylpiperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141318308 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-chloro-6-[(3R)-3-methylpiperazin-1-yl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2ncc(C(N)=O)cc2Cl)CCN1 |
| InChI | InChI=1S/C11H15ClN4O/c1-7-6-16(3-2-14-7)11-9(12)4-8(5-15-11)10(13)17/h4-5,7,14H,2-3,6H2,1H3,(H2,13,17)/t7-/m1/s1 |
| InChIKey | HAGABIUGBCSPQX-SSDOTTSWSA-N |
| XLogP | 0.63 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |