C12H16ClN3O — CID 133357797
5-chloro-6-(2,3-dimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 133357797) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 5-chloro-6-(2,3-dimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-(2,3-dimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133357797 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-chloro-6-(2,3-dimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CCN(c2ncc(C(N)=O)cc2Cl)C1C |
| InChI | InChI=1S/C12H16ClN3O/c1-7-3-4-16(8(7)2)12-10(13)5-9(6-15-12)11(14)17/h5-8H,3-4H2,1-2H3,(H2,14,17) |
| InChIKey | NLNXKFJYJPBFNY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |