C19H23ClN4O3 — CID 133362411
5-chloro-6-[3-(3,5-dimethoxyanilino)piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 133362411) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-chloro-6-[3-(3,5-dimethoxyanilino)piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[3-(3,5-dimethoxyanilino)piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133362411 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 5-chloro-6-[3-(3,5-dimethoxyanilino)piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | COc1cc(NC2CCCN(c3ncc(C(N)=O)cc3Cl)C2)cc(OC)c1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-26-15-7-14(8-16(9-15)27-2)23-13-4-3-5-24(11-13)19-17(20)6-12(10-22-19)18(21)25/h6-10,13,23H,3-5,11H2,1-2H3,(H2,21,25) |
| InChIKey | YUXICSIADCTJJZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |