C12H22N4O3S — CID 102825657
1-tert-butyl-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine (PubChem CID 102825657) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-tert-butyl-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine.
| Compound Name | 1-tert-butyl-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 102825657 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-tert-butyl-4-methylsulfonyl-3-morpholin-4-ylpyrazol-5-amine |
| SMILES | CC(C)(C)n1nc(N2CCOCC2)c(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C12H22N4O3S/c1-12(2,3)16-10(13)9(20(4,17)18)11(14-16)15-5-7-19-8-6-15/h5-8,13H2,1-4H3 |
| InChIKey | LVLQFVFLZQBAGU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |