C22H29N7O3S — CID 150825332
4-[5-methyl-6-(4-methylsulfonylpiperazin-1-yl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]aniline (PubChem CID 150825332) has the molecular formula C22H29N7O3S and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-[5-methyl-6-(4-methylsulfonylpiperazin-1-yl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]aniline.
| Compound Name | 4-[5-methyl-6-(4-methylsulfonylpiperazin-1-yl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]aniline |
|---|---|
| PubChem CID | 150825332 |
| Molecular Formula | C22H29N7O3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 4-[5-methyl-6-(4-methylsulfonylpiperazin-1-yl)-4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl]aniline |
| SMILES | Cc1c(N2CCN(S(C)(=O)=O)CC2)cn2nc(-c3ccc(N)cc3)nc(N3CCOCC3)c12 |
| InChI | InChI=1S/C22H29N7O3S/c1-16-19(26-7-9-28(10-8-26)33(2,30)31)15-29-20(16)22(27-11-13-32-14-12-27)24-21(25-29)17-3-5-18(23)6-4-17/h3-6,15H,7-14,23H2,1-2H3 |
| InChIKey | KKUMIPFGGNHZBX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|