C22H28N6O3S2 — CID 46180663
4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]aniline (PubChem CID 46180663) has the molecular formula C22H28N6O3S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 46180663 |
| Molecular Formula | C22H28N6O3S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]aniline |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4ccc(N)cc4)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C22H28N6O3S2/c1-33(29,30)28-8-6-26(7-9-28)15-18-14-19-20(32-18)22(27-10-12-31-13-11-27)25-21(24-19)16-2-4-17(23)5-3-16/h2-5,14H,6-13,15,23H2,1H3 |
| InChIKey | XIQSDGCEEMBYPW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|