C24H28N6O5S2 — CID 66588937
3-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-(4-nitrophenyl)thieno[3,2-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 66588937) has the molecular formula C24H28N6O5S2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 3-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-(4-nitrophenyl)thieno[3,2-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-(4-nitrophenyl)thieno[3,2-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 66588937 |
| Molecular Formula | C24H28N6O5S2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 3-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-2-(4-nitrophenyl)thieno[3,2-d]pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4ccc([N+](=O)[O-])cc4)nc(N4CC5CCC(C4)O5)c3s2)CC1 |
| InChI | InChI=1S/C24H28N6O5S2/c1-37(33,34)29-10-8-27(9-11-29)15-20-12-21-22(36-20)24(28-13-18-6-7-19(14-28)35-18)26-23(25-21)16-2-4-17(5-3-16)30(31)32/h2-5,12,18-19H,6-11,13-15H2,1H3 |
| InChIKey | VSXPNILQHQGGDK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 122.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|