C26H35N7O6S2 — CID 66553871
6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-yl-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 66553871) has the molecular formula C26H35N7O6S2 and a molecular weight of 605.74 g/mol. Its IUPAC name is 6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-yl-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-yl-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 66553871 |
| Molecular Formula | C26H35N7O6S2 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-yl-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | COc1ccc(/C=N/Nc2nc(N3CCOCC3)c3sc(CN4CCN(S(C)(=O)=O)CC4)cc3n2)c(OC)c1OC |
| InChI | InChI=1S/C26H35N7O6S2/c1-36-21-6-5-18(22(37-2)23(21)38-3)16-27-30-26-28-20-15-19(17-31-7-9-33(10-8-31)41(4,34)35)40-24(20)25(29-26)32-11-13-39-14-12-32/h5-6,15-16H,7-14,17H2,1-4H3,(H,28,29,30)/b27-16+ |
| InChIKey | IZUNYBZVQOEGRX-JVWAILMASA-N |
| XLogP | 2.08 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|