C16H25N7O3S2 — CID 66553869
[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]hydrazine (PubChem CID 66553869) has the molecular formula C16H25N7O3S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is [6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 66553869 |
| Molecular Formula | C16H25N7O3S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]hydrazine |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(NN)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C16H25N7O3S2/c1-28(24,25)23-4-2-21(3-5-23)11-12-10-13-14(27-12)15(19-16(18-13)20-17)22-6-8-26-9-7-22/h10H,2-9,11,17H2,1H3,(H,18,19,20) |
| InChIKey | ZGZMYIZCWGOQFJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|