C30H41N9O5S2 — CID 59474311
N-hydroxy-7-[[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-1H-indazol-3-yl]amino]heptanamide (PubChem CID 59474311) has the molecular formula C30H41N9O5S2 and a molecular weight of 671.85 g/mol. Its IUPAC name is N-hydroxy-7-[[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-1H-indazol-3-yl]amino]heptanamide.
| Compound Name | N-hydroxy-7-[[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-1H-indazol-3-yl]amino]heptanamide |
|---|---|
| PubChem CID | 59474311 |
| Molecular Formula | C30H41N9O5S2 |
| Molecular Weight | 671.85 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | N-hydroxy-7-[[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-1H-indazol-3-yl]amino]heptanamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]nc(NCCCCCCC(=O)NO)c45)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C30H41N9O5S2/c1-46(42,43)39-13-11-37(12-14-39)20-21-19-24-27(45-21)30(38-15-17-44-18-16-38)33-28(32-24)22-7-6-8-23-26(22)29(35-34-23)31-10-5-3-2-4-9-25(40)36-41/h6-8,19,41H,2-5,9-18,20H2,1H3,(H,36,40)(H2,31,34,35) |
| InChIKey | SRVHAGLIUCLZIS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 168.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|