C27H35N8O5S2+ — CID 166501491
N-hydroxy-4-[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-3aH-indazol-2-ium-2-yl]butanamide (PubChem CID 166501491) has the molecular formula C27H35N8O5S2+ and a molecular weight of 615.76 g/mol. Its IUPAC name is N-hydroxy-4-[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-3aH-indazol-2-ium-2-yl]butanamide.
| Compound Name | N-hydroxy-4-[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-3aH-indazol-2-ium-2-yl]butanamide |
|---|---|
| PubChem CID | 166501491 |
| Molecular Formula | C27H35N8O5S2+ |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | N-hydroxy-4-[4-[6-[(4-methylsulfonylpiperazin-1-yl)methyl]-4-morpholin-4-ylthieno[3,2-d]pyrimidin-2-yl]-3aH-indazol-2-ium-2-yl]butanamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(C4=CC=CC5=N[N+](CCCC(=O)NO)=CC45)nc(N4CCOCC4)c3s2)CC1 |
| InChI | InChI=1S/C27H34N8O5S2/c1-42(38,39)35-10-8-32(9-11-35)17-19-16-23-25(41-19)27(33-12-14-40-15-13-33)29-26(28-23)20-4-2-5-22-21(20)18-34(30-22)7-3-6-24(36)31-37/h2,4-5,16,18,21H,3,6-15,17H2,1H3,(H-,28,29,30,31,36,37)/p+1 |
| InChIKey | RTJRYVORNPDPRV-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|