C31H43N9O4S2 — CID 54575109
N-hydroxy-8-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]octanamide (PubChem CID 54575109) has the molecular formula C31H43N9O4S2 and a molecular weight of 669.88 g/mol. Its IUPAC name is N-hydroxy-8-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]octanamide.
| Compound Name | N-hydroxy-8-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]octanamide |
|---|---|
| PubChem CID | 54575109 |
| Molecular Formula | C31H43N9O4S2 |
| Molecular Weight | 669.88 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | N-hydroxy-8-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]octanamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCN(CCCCCCCC(=O)NO)CC4)c3s2)CC1 |
| InChI | InChI=1S/C31H43N9O4S2/c1-46(43,44)40-18-14-38(15-19-40)22-23-20-27-29(45-23)31(34-30(33-27)24-8-7-9-26-25(24)21-32-35-26)39-16-12-37(13-17-39)11-6-4-2-3-5-10-28(41)36-42/h7-9,20-21,42H,2-6,10-19,22H2,1H3,(H,32,35)(H,36,41) |
| InChIKey | DBHJAFBHTOBSDL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 150.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|