C28H37N9O4S2 — CID 59474334
N-hydroxy-5-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfanylperoxypiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]pentanamide (PubChem CID 59474334) has the molecular formula C28H37N9O4S2 and a molecular weight of 627.80 g/mol. Its IUPAC name is N-hydroxy-5-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfanylperoxypiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]pentanamide.
| Compound Name | N-hydroxy-5-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfanylperoxypiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]pentanamide |
|---|---|
| PubChem CID | 59474334 |
| Molecular Formula | C28H37N9O4S2 |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | N-hydroxy-5-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfanylperoxypiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]pentanamide |
| SMILES | CSOON1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCN(CCCCC(=O)NO)CC4)c3s2)CC1 |
| InChI | InChI=1S/C28H37N9O4S2/c1-42-41-40-37-15-11-35(12-16-37)19-20-17-24-26(43-20)28(31-27(30-24)21-5-4-6-23-22(21)18-29-32-23)36-13-9-34(10-14-36)8-3-2-7-25(38)33-39/h4-6,17-18,39H,2-3,7-16,19H2,1H3,(H,29,32)(H,33,38) |
| InChIKey | IVDXDPRGBVXQJR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|