C16H15ClN4O3 — CID 86665885
3-[2-chloro-6-(4-nitrophenyl)pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 86665885) has the molecular formula C16H15ClN4O3 and a molecular weight of 346.77 g/mol. Its IUPAC name is 3-[2-chloro-6-(4-nitrophenyl)pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-[2-chloro-6-(4-nitrophenyl)pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 86665885 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[2-chloro-6-(4-nitrophenyl)pyrimidin-4-yl]-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(N3CC4CCC(C3)O4)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C16H15ClN4O3/c17-16-18-14(10-1-3-11(4-2-10)21(22)23)7-15(19-16)20-8-12-5-6-13(9-20)24-12/h1-4,7,12-13H,5-6,8-9H2 |
| InChIKey | ASWTWOPKLRYIKM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|