C15H17N3O3S — CID 777785
(2S,6S)-2,6-dimethyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 777785) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | (2S,6S)-2,6-dimethyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 777785 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | C[C@H]1CN(c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10-7-17(8-11(2)21-10)15-16-14(9-22-15)12-3-5-13(6-4-12)18(19)20/h3-6,9-11H,7-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | YZLWKUAQULHULQ-QWRGUYRKSA-N |
| XLogP | 3.33 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|