C11H16N3O3+ — CID 7188368
(2R,6S)-2,6-dimethyl-4-(5-nitropyridin-1-ium-2-yl)morpholine (PubChem CID 7188368) has the molecular formula C11H16N3O3+ and a molecular weight of 238.27 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-(5-nitropyridin-1-ium-2-yl)morpholine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-(5-nitropyridin-1-ium-2-yl)morpholine |
|---|---|
| PubChem CID | 7188368 |
| Molecular Formula | C11H16N3O3+ |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-(5-nitropyridin-1-ium-2-yl)morpholine |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])c[nH+]2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15N3O3/c1-8-6-13(7-9(2)17-8)11-4-3-10(5-12-11)14(15)16/h3-5,8-9H,6-7H2,1-2H3/p+1/t8-,9+ |
| InChIKey | OEWWQMFPALMWEF-DTORHVGOSA-O |
| XLogP | 1.02 |
| TPSA | 69.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|