C18H13N5O3S — CID 56849928
5-methyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-phenyl-1,2,4-triazol-3-one (PubChem CID 56849928) has the molecular formula C18H13N5O3S and a molecular weight of 379.40 g/mol. Its IUPAC name is 5-methyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-phenyl-1,2,4-triazol-3-one.
| Compound Name | 5-methyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 56849928 |
| Molecular Formula | C18H13N5O3S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-methyl-4-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-phenyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(-c2ccccc2)c(=O)n1-c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C18H13N5O3S/c1-12-20-22(14-5-3-2-4-6-14)18(24)21(12)17-19-16(11-27-17)13-7-9-15(10-8-13)23(25)26/h2-11H,1H3 |
| InChIKey | UBDHIHFUTIJTCE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|