C15H13N3O2S — CID 86579154
2-(2,5-dimethylpyrrol-1-yl)-4-(3-nitrophenyl)-1,3-thiazole (PubChem CID 86579154) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-4-(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-4-(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 86579154 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-4-(3-nitrophenyl)-1,3-thiazole |
| SMILES | Cc1ccc(C)n1-c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C15H13N3O2S/c1-10-6-7-11(2)17(10)15-16-14(9-21-15)12-4-3-5-13(8-12)18(19)20/h3-9H,1-2H3 |
| InChIKey | UXZZOJMAJXAFGR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|