C30H20N8O3S — CID 6801122
5-(4-nitrophenyl)-4-[(4-phenyldiazenylphenyl)hydrazinylidene]-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one (PubChem CID 6801122) has the molecular formula C30H20N8O3S and a molecular weight of 572.61 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-4-[(4-phenyldiazenylphenyl)hydrazinylidene]-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one.
| Compound Name | 5-(4-nitrophenyl)-4-[(4-phenyldiazenylphenyl)hydrazinylidene]-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 6801122 |
| Molecular Formula | C30H20N8O3S |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 5-(4-nitrophenyl)-4-[(4-phenyldiazenylphenyl)hydrazinylidene]-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
| SMILES | O=C1C(=NNc2ccc(/N=N/c3ccccc3)cc2)C(c2ccc([N+](=O)[O-])cc2)=NN1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C30H20N8O3S/c39-29-28(35-34-24-15-13-23(14-16-24)33-32-22-9-5-2-6-10-22)27(21-11-17-25(18-12-21)38(40)41)36-37(29)30-31-26(19-42-30)20-7-3-1-4-8-20/h1-19,34H/b33-32+,35-28? |
| InChIKey | DPCAVQLZFKLJKV-ZVZCYIDFSA-N |
| XLogP | 7.35 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|