C13H11N3O2S — CID 103097271
2-methyl-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]propanenitrile (PubChem CID 103097271) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-methyl-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]propanenitrile.
| Compound Name | 2-methyl-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 103097271 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-methyl-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]propanenitrile |
| SMILES | CC(C)(C#N)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C13H11N3O2S/c1-13(2,8-14)12-15-11(7-19-12)9-3-5-10(6-4-9)16(17)18/h3-7H,1-2H3 |
| InChIKey | ADDWCPPLRVVVTQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|