C17H10ClN3O2S — CID 71250683
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetonitrile (PubChem CID 71250683) has the molecular formula C17H10ClN3O2S and a molecular weight of 355.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetonitrile |
|---|---|
| PubChem CID | 71250683 |
| Molecular Formula | C17H10ClN3O2S |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetonitrile |
| SMILES | N#CC(c1ccc([N+](=O)[O-])cc1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C17H10ClN3O2S/c18-13-5-1-12(2-6-13)16-10-24-17(20-16)15(9-19)11-3-7-14(8-4-11)21(22)23/h1-8,10,15H |
| InChIKey | DHISQKBWWLMVMQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|