C10H5ClN2S — CID 75465441
4-(4-chlorophenyl)-1,3-thiazole-2-carbonitrile (PubChem CID 75465441) has the molecular formula C10H5ClN2S and a molecular weight of 220.68 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3-thiazole-2-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-1,3-thiazole-2-carbonitrile |
|---|---|
| PubChem CID | 75465441 |
| Molecular Formula | C10H5ClN2S |
| Molecular Weight | 220.68 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3-thiazole-2-carbonitrile |
| SMILES | N#Cc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C10H5ClN2S/c11-8-3-1-7(2-4-8)9-6-14-10(5-12)13-9/h1-4,6H |
| InChIKey | WONOJZYBJGRKIL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |