C11H10ClNS — CID 2804464
4-(4-chlorophenyl)-2-ethyl-1,3-thiazole (PubChem CID 2804464) has the molecular formula C11H10ClNS and a molecular weight of 223.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-ethyl-1,3-thiazole.
| Compound Name | 4-(4-chlorophenyl)-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 2804464 |
| Molecular Formula | C11H10ClNS |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4-(4-chlorophenyl)-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C11H10ClNS/c1-2-11-13-10(7-14-11)8-3-5-9(12)6-4-8/h3-7H,2H2,1H3 |
| InChIKey | CFVFCXSQSADCGC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |