C9H8ClN3S — CID 127016569
4-(4-chloropyrimidin-2-yl)-2-ethyl-1,3-thiazole (PubChem CID 127016569) has the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. Its IUPAC name is 4-(4-chloropyrimidin-2-yl)-2-ethyl-1,3-thiazole.
| Compound Name | 4-(4-chloropyrimidin-2-yl)-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 127016569 |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 4-(4-chloropyrimidin-2-yl)-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc(-c2nccc(Cl)n2)cs1 |
| InChI | InChI=1S/C9H8ClN3S/c1-2-8-12-6(5-14-8)9-11-4-3-7(10)13-9/h3-5H,2H2,1H3 |
| InChIKey | GPPCVRLSOTVQOY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |