C16H11ClN2OS — CID 112731541
1-(2-chloro-4-pyridinyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone (PubChem CID 112731541) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(2-chloro-4-pyridinyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 112731541 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-2-(4-phenyl-1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)cs1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-15-8-12(6-7-18-15)14(20)9-16-19-13(10-21-16)11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | BWARCAMGHPOHLP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|