C15H11N3OS — CID 102923178
2-(4-phenyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethanone (PubChem CID 102923178) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethanone.
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethanone |
|---|---|
| PubChem CID | 102923178 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)-1-pyrimidin-5-ylethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)cs1)c1cncnc1 |
| InChI | InChI=1S/C15H11N3OS/c19-14(12-7-16-10-17-8-12)6-15-18-13(9-20-15)11-4-2-1-3-5-11/h1-5,7-10H,6H2 |
| InChIKey | GNCWBYFYGOULEY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |