C16H13N3OS — CID 82067010
1-(4-aminophenyl)-2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethanone (PubChem CID 82067010) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(4-aminophenyl)-2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 82067010 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(4-aminophenyl)-2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethanone |
| SMILES | Nc1ccc(C(=O)Cc2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C16H13N3OS/c17-12-6-4-11(5-7-12)15(20)9-16-19-14(10-21-16)13-3-1-2-8-18-13/h1-8,10H,9,17H2 |
| InChIKey | UZPSLLVIOCNSIT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|