C12H13N3O2S — CID 116969262
3-amino-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanoic acid (PubChem CID 116969262) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-amino-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanoic acid.
| Compound Name | 3-amino-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 116969262 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-amino-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanoic acid |
| SMILES | NC(CC(=O)O)Cc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C12H13N3O2S/c13-8(6-12(16)17)5-11-15-10(7-18-11)9-3-1-2-4-14-9/h1-4,7-8H,5-6,13H2,(H,16,17) |
| InChIKey | URJIGYQRNVOSJZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |