C20H18N2O2S — CID 6265947
4-(4-nitrophenyl)-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]-1,3-thiazole (PubChem CID 6265947) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]-1,3-thiazole.
| Compound Name | 4-(4-nitrophenyl)-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 6265947 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-(4-nitrophenyl)-2-[(E)-2-(4-propan-2-ylphenyl)ethenyl]-1,3-thiazole |
| SMILES | CC(C)c1ccc(/C=C/c2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1 |
| InChI | InChI=1S/C20H18N2O2S/c1-14(2)16-6-3-15(4-7-16)5-12-20-21-19(13-25-20)17-8-10-18(11-9-17)22(23)24/h3-14H,1-2H3/b12-5+ |
| InChIKey | JDPNGQBQOVETGN-LFYBBSHMSA-N |
| XLogP | 6.01 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|