C22H15BrN2O3S — CID 4570126
2-[2-[5-(2-bromo-4-nitrophenyl)furan-2-yl]ethenyl]-4-(4-methylphenyl)-1,3-thiazole (PubChem CID 4570126) has the molecular formula C22H15BrN2O3S and a molecular weight of 467.34 g/mol. Its IUPAC name is 2-[2-[5-(2-bromo-4-nitrophenyl)furan-2-yl]ethenyl]-4-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 2-[2-[5-(2-bromo-4-nitrophenyl)furan-2-yl]ethenyl]-4-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 4570126 |
| Molecular Formula | C22H15BrN2O3S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | 2-[2-[5-(2-bromo-4-nitrophenyl)furan-2-yl]ethenyl]-4-(4-methylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(-c2csc(C=Cc3ccc(-c4ccc([N+](=O)[O-])cc4Br)o3)n2)cc1 |
| InChI | InChI=1S/C22H15BrN2O3S/c1-14-2-4-15(5-3-14)20-13-29-22(24-20)11-8-17-7-10-21(28-17)18-9-6-16(25(26)27)12-19(18)23/h2-13H,1H3 |
| InChIKey | ZQRAWGRQLXZGLT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|