C17H11ClN2O2S — CID 6028763
2-[(E)-2-(3-chlorophenyl)ethenyl]-4-(4-nitrophenyl)-1,3-thiazole (PubChem CID 6028763) has the molecular formula C17H11ClN2O2S and a molecular weight of 342.81 g/mol. Its IUPAC name is 2-[(E)-2-(3-chlorophenyl)ethenyl]-4-(4-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-[(E)-2-(3-chlorophenyl)ethenyl]-4-(4-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 6028763 |
| Molecular Formula | C17H11ClN2O2S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[(E)-2-(3-chlorophenyl)ethenyl]-4-(4-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(/C=C/c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C17H11ClN2O2S/c18-14-3-1-2-12(10-14)4-9-17-19-16(11-23-17)13-5-7-15(8-6-13)20(21)22/h1-11H/b9-4+ |
| InChIKey | JFTYBOQUNMWWNL-RUDMXATFSA-N |
| XLogP | 5.54 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|