C15H15ClN2O2S — CID 67723463
4-cyclobutyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole;hydrochloride (PubChem CID 67723463) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 4-cyclobutyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole;hydrochloride.
| Compound Name | 4-cyclobutyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 67723463 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-cyclobutyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(C=Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C15H14N2O2S.ClH/c18-17(19)13-6-1-3-11(9-13)7-8-15-16-14(10-20-15)12-4-2-5-12;/h1,3,6-10,12H,2,4-5H2;1H |
| InChIKey | MTQOMNSTDMKXJA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|