C17H18N2O2S — CID 54482005
4-cyclohexyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole (PubChem CID 54482005) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-cyclohexyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole.
| Compound Name | 4-cyclohexyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 54482005 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-cyclohexyl-2-[2-(3-nitrophenyl)ethenyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cccc(C=Cc2nc(C3CCCCC3)cs2)c1 |
| InChI | InChI=1S/C17H18N2O2S/c20-19(21)15-8-4-5-13(11-15)9-10-17-18-16(12-22-17)14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7H2 |
| InChIKey | XPQNZXRXRYFDBV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|